C29H34F3N5O4S — CID 66817900
1-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(4,4,4-trifluorobutyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea (PubChem CID 66817900) has the molecular formula C29H34F3N5O4S and a molecular weight of 605.68 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(4,4,4-trifluorobutyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea.
| Compound Name | 1-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(4,4,4-trifluorobutyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 66817900 |
| Molecular Formula | C29H34F3N5O4S |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 1-[3,5-dimethyl-4-[(E)-2-[[4-oxo-2-[3-(4,4,4-trifluorobutyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea |
| SMILES | Cc1cc(N(C)C(N)=O)cc(C)c1/C=C/S(=O)(=O)N1CCC2(CC1)N=C(c1cccc(CCCC(F)(F)F)c1)NC2=O |
| InChI | InChI=1S/C29H34F3N5O4S/c1-19-16-23(36(3)27(33)39)17-20(2)24(19)9-15-42(40,41)37-13-11-28(12-14-37)26(38)34-25(35-28)22-8-4-6-21(18-22)7-5-10-29(30,31)32/h4,6,8-9,15-18H,5,7,10-14H2,1-3H3,(H2,33,39)(H,34,35,38)/b15-9+ |
| InChIKey | AFTCGDIPAVLVIE-OQLLNIDSSA-N |
| XLogP | 4.42 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |