C30H36F5N5O5S — CID 87166398
1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(4,4,5,5,5-pentafluoropentoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea (PubChem CID 87166398) has the molecular formula C30H36F5N5O5S and a molecular weight of 673.71 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(4,4,5,5,5-pentafluoropentoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea.
| Compound Name | 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(4,4,5,5,5-pentafluoropentoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 87166398 |
| Molecular Formula | C30H36F5N5O5S |
| Molecular Weight | 673.71 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(4,4,5,5,5-pentafluoropentoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea |
| SMILES | Cc1cc(N(C)C(N)=O)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(c1cccc(OCCCC(F)(F)C(F)(F)F)c1)NC2=O |
| InChI | InChI=1S/C30H36F5N5O5S/c1-19-16-22(39(3)27(36)42)17-20(2)24(19)8-15-46(43,44)40-12-10-28(11-13-40)26(41)37-25(38-28)21-6-4-7-23(18-21)45-14-5-9-29(31,32)30(33,34)35/h4,6-7,16-18H,5,8-15H2,1-3H3,(H2,36,42)(H,37,38,41) |
| InChIKey | PYUSWOBYBNKKDS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|