C32H47F5N4O5S — CID 89113806
tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate (PubChem CID 89113806) has the molecular formula C32H47F5N4O5S and a molecular weight of 694.81 g/mol. Its IUPAC name is tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 89113806 |
| Molecular Formula | C32H47F5N4O5S |
| Molecular Weight | 694.81 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(8,8,9,9,9-pentafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate |
| SMILES | Cc1cc(N(C)C(=O)OC(C)(C)C)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(CCCCCCCC(F)(F)C(F)(F)F)NC2=O |
| InChI | InChI=1S/C32H47F5N4O5S/c1-22-20-24(40(6)28(43)46-29(3,4)5)21-23(2)25(22)13-19-47(44,45)41-17-15-30(16-18-41)27(42)38-26(39-30)12-10-8-7-9-11-14-31(33,34)32(35,36)37/h20-21H,7-19H2,1-6H3,(H,38,39,42) |
| InChIKey | LELXADYNCIRJRV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.81 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|