C28H41F4N5O4S — CID 66818436
1-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea (PubChem CID 66818436) has the molecular formula C28H41F4N5O4S and a molecular weight of 619.73 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea.
| Compound Name | 1-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 66818436 |
| Molecular Formula | C28H41F4N5O4S |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | 1-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1-methylurea |
| SMILES | Cc1cc(N(C)C(N)=O)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(C(F)CCCCCCCC(F)(F)F)NC2=O |
| InChI | InChI=1S/C28H41F4N5O4S/c1-19-17-21(36(3)26(33)39)18-20(2)22(19)10-16-42(40,41)37-14-12-27(13-15-37)25(38)34-24(35-27)23(29)9-7-5-4-6-8-11-28(30,31)32/h17-18,23H,4-16H2,1-3H3,(H2,33,39)(H,34,35,38) |
| InChIKey | ZNQGNPVZIWMJHA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|