C29H32F3N5O5S — CID 74766529
1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 74766529) has the molecular formula C29H32F3N5O5S and a molecular weight of 619.67 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 74766529 |
| Molecular Formula | C29H32F3N5O5S |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1cc(N2C(=O)NC(=O)C2(C)C)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(c1cccc(C(F)(F)F)c1)NC2=O |
| InChI | InChI=1S/C29H32F3N5O5S/c1-17-14-21(37-26(40)34-24(38)27(37,3)4)15-18(2)22(17)8-13-43(41,42)36-11-9-28(10-12-36)25(39)33-23(35-28)19-6-5-7-20(16-19)29(30,31)32/h5-7,14-16H,8-13H2,1-4H3,(H,33,35,39)(H,34,38,40) |
| InChIKey | DNZSNNGXYXKSDK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|