C11H13N — CID 123558907
4-methyl-7,8-dihydro-5H-cyclopenta[c]azocine (PubChem CID 123558907) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 4-methyl-7,8-dihydro-5H-cyclopenta[c]azocine.
| Compound Name | 4-methyl-7,8-dihydro-5H-cyclopenta[c]azocine |
|---|---|
| PubChem CID | 123558907 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 4-methyl-7,8-dihydro-5H-cyclopenta[c]azocine |
| SMILES | CC1=C/N=C\C2=CCCC2=CC1 |
| InChI | InChI=1S/C11H13N/c1-9-5-6-10-3-2-4-11(10)8-12-7-9/h4,6-8H,2-3,5H2,1H3/b9-7?,10-6?,12-8- |
| InChIKey | ZSCKFWJEUXGUDW-BBWWDAOXSA-N |
| XLogP | 3.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |