C14H14BiN — CID 170984119
(12Z)-6,7,8,9-tetrahydrobenzo[b][5,1]benzazabismocine (PubChem CID 170984119) has the molecular formula C14H14BiN and a molecular weight of 405.25 g/mol. Its IUPAC name is (12Z)-6,7,8,9-tetrahydrobenzo[b][5,1]benzazabismocine.
| Compound Name | (12Z)-6,7,8,9-tetrahydrobenzo[b][5,1]benzazabismocine |
|---|---|
| PubChem CID | 170984119 |
| Molecular Formula | C14H14BiN |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (12Z)-6,7,8,9-tetrahydrobenzo[b][5,1]benzazabismocine |
| SMILES | C1=N\C=c2\cccc\c2=[Bi]\C2=C/1CCCC2 |
| InChI | InChI=1S/C14H14N.Bi/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;/h1,3-4,7,11-12H,2,5-6,9H2;/b13-11-,15-12-; |
| InChIKey | SENDSOULTAKBJZ-TVXQHPIZSA-N |
| XLogP | 2.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |