C11H11N — CID 90989910
7-methylidene-5,6-dihydro-2-benzazepine (PubChem CID 90989910) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 7-methylidene-5,6-dihydro-2-benzazepine.
| Compound Name | 7-methylidene-5,6-dihydro-2-benzazepine |
|---|---|
| PubChem CID | 90989910 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 7-methylidene-5,6-dihydro-2-benzazepine |
| SMILES | C=C1C=CC2=C(CC=CN=C2)C1 |
| InChI | InChI=1S/C11H11N/c1-9-4-5-11-8-12-6-2-3-10(11)7-9/h2,4-6,8H,1,3,7H2 |
| InChIKey | KBRKJBBOJOLLSD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |