C9H9N — CID 45079920
6,7-dihydroisoquinoline (PubChem CID 45079920) has the molecular formula C9H9N and a molecular weight of 131.18 g/mol. Its IUPAC name is 6,7-dihydroisoquinoline.
| Compound Name | 6,7-dihydroisoquinoline |
|---|---|
| PubChem CID | 45079920 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 6,7-dihydroisoquinoline |
| SMILES | C1=c2ccncc2=CCC1 |
| InChI | InChI=1S/C9H9N/c1-2-4-9-7-10-6-5-8(9)3-1/h3-7H,1-2H2 |
| InChIKey | SOSACGIAOSVYGO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |