About 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate
4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate (PubChem CID 123558940) has the molecular formula C22H27NO2
and a molecular weight of 337.46 g/mol. Its IUPAC name is 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate.
Molecular Properties
| Compound Name | 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate |
| PubChem CID | 123558940 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate |
| SMILES | CC(CC(C)(C)C)OC(=O)CN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO2/c1-17(15-22(2,3)4)25-20(24)16-23-21(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17H,15-16H2,1-4H3 |
| InChIKey | JEWUGCBOZFFFKQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate?
The IUPAC name of 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate (CID 123558940) is 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate.
What is the SMILES notation for 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate?
The canonical SMILES for 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate is CC(CC(C)(C)C)OC(=O)CN=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate?
The InChIKey is JEWUGCBOZFFFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO2/c1-17(15-22(2,3)4)25-20(24)16-23-21(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17H,15-16H2,1-4H3.
What are the key properties of 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate?
4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate has a molecular weight of 337.46 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylpentan-2-yl 2-(benzhydrylideneamino)acetate is sourced from PubChem (CID 123558940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).