C25H22FN5O — CID 123559143
4-[3-fluoro-1-[5-[2-(isocyanomethyl)-5-methyl-1H-imidazol-4-yl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile (PubChem CID 123559143) has the molecular formula C25H22FN5O and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-[3-fluoro-1-[5-[2-(isocyanomethyl)-5-methyl-1H-imidazol-4-yl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile.
| Compound Name | 4-[3-fluoro-1-[5-[2-(isocyanomethyl)-5-methyl-1H-imidazol-4-yl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 123559143 |
| Molecular Formula | C25H22FN5O |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[3-fluoro-1-[5-[2-(isocyanomethyl)-5-methyl-1H-imidazol-4-yl]-2,4-dimethylbenzoyl]azetidin-3-yl]benzonitrile |
| SMILES | [C-]#[N+]Cc1nc(-c2cc(C(=O)N3CC(F)(c4ccc(C#N)cc4)C3)c(C)cc2C)c(C)[nH]1 |
| InChI | InChI=1S/C25H22FN5O/c1-15-9-16(2)21(10-20(15)23-17(3)29-22(30-23)12-28-4)24(32)31-13-25(26,14-31)19-7-5-18(11-27)6-8-19/h5-10H,12-14H2,1-3H3,(H,29,30) |
| InChIKey | PXHMZVPMTZSKRE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|