C8H15N — CID 123561451
N-(2,3-dimethylbut-1-enyl)ethanimine (PubChem CID 123561451) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is N-(2,3-dimethylbut-1-enyl)ethanimine.
| Compound Name | N-(2,3-dimethylbut-1-enyl)ethanimine |
|---|---|
| PubChem CID | 123561451 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | N-(2,3-dimethylbut-1-enyl)ethanimine |
| SMILES | C/C=N/C=C(C)C(C)C |
| InChI | InChI=1S/C8H15N/c1-5-9-6-8(4)7(2)3/h5-7H,1-4H3/b8-6?,9-5+ |
| InChIKey | KHVYVIQGFLSQNN-JUIIZTTKSA-N |
| XLogP | 2.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|