C12H22F3N — CID 142399738
N-[(E)-2,3-dimethylbut-1-enyl]-4,4,4-trifluorobutan-1-imine;ethane (PubChem CID 142399738) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is N-[(E)-2,3-dimethylbut-1-enyl]-4,4,4-trifluorobutan-1-imine;ethane.
| Compound Name | N-[(E)-2,3-dimethylbut-1-enyl]-4,4,4-trifluorobutan-1-imine;ethane |
|---|---|
| PubChem CID | 142399738 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-[(E)-2,3-dimethylbut-1-enyl]-4,4,4-trifluorobutan-1-imine;ethane |
| SMILES | C/C(=C\N=C\CCC(F)(F)F)C(C)C.CC |
| InChI | InChI=1S/C10H16F3N.C2H6/c1-8(2)9(3)7-14-6-4-5-10(11,12)13;1-2/h6-8H,4-5H2,1-3H3;1-2H3/b9-7+,14-6+; |
| InChIKey | OMBYFFZQIKJBIV-CVNVEYKZSA-N |
| XLogP | 4.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|