C11H18F3N — CID 142360122
4,4,4-trifluoro-N-[(E)-2,3,3-trimethylbut-1-enyl]butan-1-imine (PubChem CID 142360122) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(E)-2,3,3-trimethylbut-1-enyl]butan-1-imine.
| Compound Name | 4,4,4-trifluoro-N-[(E)-2,3,3-trimethylbut-1-enyl]butan-1-imine |
|---|---|
| PubChem CID | 142360122 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4,4,4-trifluoro-N-[(E)-2,3,3-trimethylbut-1-enyl]butan-1-imine |
| SMILES | C/C(=C\N=C\CCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C11H18F3N/c1-9(10(2,3)4)8-15-7-5-6-11(12,13)14/h7-8H,5-6H2,1-4H3/b9-8+,15-7+ |
| InChIKey | MIUYWWMSPVMDRQ-ZGKCIRJHSA-N |
| XLogP | 4.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|