C28H33ClN6O2 — CID 123562583
6-[2-chloro-4-(3-methylpyrazin-2-yl)phenyl]-2-(1-ethoxyhexan-3-ylamino)-8-ethylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 123562583) has the molecular formula C28H33ClN6O2 and a molecular weight of 521.07 g/mol. Its IUPAC name is 6-[2-chloro-4-(3-methylpyrazin-2-yl)phenyl]-2-(1-ethoxyhexan-3-ylamino)-8-ethylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-[2-chloro-4-(3-methylpyrazin-2-yl)phenyl]-2-(1-ethoxyhexan-3-ylamino)-8-ethylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 123562583 |
| Molecular Formula | C28H33ClN6O2 |
| Molecular Weight | 521.07 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 6-[2-chloro-4-(3-methylpyrazin-2-yl)phenyl]-2-(1-ethoxyhexan-3-ylamino)-8-ethylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCC(CCOCC)Nc1ncc2cc(-c3ccc(-c4nccnc4C)cc3Cl)c(=O)n(CC)c2n1 |
| InChI | InChI=1S/C28H33ClN6O2/c1-5-8-21(11-14-37-7-3)33-28-32-17-20-15-23(27(36)35(6-2)26(20)34-28)22-10-9-19(16-24(22)29)25-18(4)30-12-13-31-25/h9-10,12-13,15-17,21H,5-8,11,14H2,1-4H3,(H,32,33,34) |
| InChIKey | WLCIEMHEWCEAIE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.07 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|