C31H39N3O4S — CID 123563609
5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[(1R)-4-(pyridin-2-ylmethoxyamino)cyclohex-3-en-1-yl]amino]thiophene-2-carboxylic acid (PubChem CID 123563609) has the molecular formula C31H39N3O4S and a molecular weight of 549.74 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[(1R)-4-(pyridin-2-ylmethoxyamino)cyclohex-3-en-1-yl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[(1R)-4-(pyridin-2-ylmethoxyamino)cyclohex-3-en-1-yl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 123563609 |
| Molecular Formula | C31H39N3O4S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[(4-methylcyclohexanecarbonyl)-[(1R)-4-(pyridin-2-ylmethoxyamino)cyclohex-3-en-1-yl]amino]thiophene-2-carboxylic acid |
| SMILES | CC1CCC(C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)[C@H]2CC=C(NOCc3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C31H39N3O4S/c1-21-8-10-22(11-9-21)29(35)34(27-19-26(16-17-31(2,3)4)39-28(27)30(36)37)25-14-12-23(13-15-25)33-38-20-24-7-5-6-18-32-24/h5-7,12,18-19,21-22,25,33H,8-11,13-15,20H2,1-4H3,(H,36,37)/t21?,22?,25-/m0/s1 |
| InChIKey | PZUMNTKEOXQUKX-OWWUNANSSA-N |
| XLogP | 6.56 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|