C26H35NO3S — CID 86711779
methyl 3-[cyclohex-3-en-1-yl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylate (PubChem CID 86711779) has the molecular formula C26H35NO3S and a molecular weight of 441.64 g/mol. Its IUPAC name is methyl 3-[cyclohex-3-en-1-yl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-[cyclohex-3-en-1-yl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86711779 |
| Molecular Formula | C26H35NO3S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | methyl 3-[cyclohex-3-en-1-yl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C#CC(C)(C)C)cc1N(C(=O)C1CCC(C)CC1)C1CC=CCC1 |
| InChI | InChI=1S/C26H35NO3S/c1-18-11-13-19(14-12-18)24(28)27(20-9-7-6-8-10-20)22-17-21(15-16-26(2,3)4)31-23(22)25(29)30-5/h6-7,17-20H,8-14H2,1-5H3 |
| InChIKey | ULDIAHPJUMDNKR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|