C21H29NO4S — CID 71101133
methyl 5-(3,3-dimethylbut-1-ynyl)-3-[(4-hydroxycyclohexyl)-propanoylamino]thiophene-2-carboxylate (PubChem CID 71101133) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is methyl 5-(3,3-dimethylbut-1-ynyl)-3-[(4-hydroxycyclohexyl)-propanoylamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[(4-hydroxycyclohexyl)-propanoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 71101133 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[(4-hydroxycyclohexyl)-propanoylamino]thiophene-2-carboxylate |
| SMILES | CCC(=O)N(c1cc(C#CC(C)(C)C)sc1C(=O)OC)C1CCC(O)CC1 |
| InChI | InChI=1S/C21H29NO4S/c1-6-18(24)22(14-7-9-15(23)10-8-14)17-13-16(11-12-21(2,3)4)27-19(17)20(25)26-5/h13-15,23H,6-10H2,1-5H3 |
| InChIKey | QYYZHMAFYNFRRQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|