C25H35NO3S — CID 90347519
N-[2-acetyl-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-N-(4-hydroxycyclohexyl)cyclohexanecarboxamide (PubChem CID 90347519) has the molecular formula C25H35NO3S and a molecular weight of 429.63 g/mol. Its IUPAC name is N-[2-acetyl-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-N-(4-hydroxycyclohexyl)cyclohexanecarboxamide.
| Compound Name | N-[2-acetyl-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-N-(4-hydroxycyclohexyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 90347519 |
| Molecular Formula | C25H35NO3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-[2-acetyl-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-N-(4-hydroxycyclohexyl)cyclohexanecarboxamide |
| SMILES | CC(=O)c1sc(C#CC(C)(C)C)cc1N(C(=O)C1CCCCC1)C1CCC(O)CC1 |
| InChI | InChI=1S/C25H35NO3S/c1-17(27)23-22(16-21(30-23)14-15-25(2,3)4)26(19-10-12-20(28)13-11-19)24(29)18-8-6-5-7-9-18/h16,18-20,28H,5-13H2,1-4H3 |
| InChIKey | ZVIKPGYSLIDNBT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|