C26H35NO4S — CID 67034499
5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylic acid (PubChem CID 67034499) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67034499 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-hydroxycyclohexyl)amino]thiophene-2-carboxylic acid |
| SMILES | CC1=CC[C@@H](C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)C2CCC(O)CC2)[C@H](C)C1 |
| InChI | InChI=1S/C26H35NO4S/c1-16-6-11-21(17(2)14-16)24(29)27(18-7-9-19(28)10-8-18)22-15-20(12-13-26(3,4)5)32-23(22)25(30)31/h6,15,17-19,21,28H,7-11,14H2,1-5H3,(H,30,31)/t17-,18?,19?,21-/m1/s1 |
| InChIKey | QMRBTIZFOIBOGH-YXUAKONQSA-N |
| XLogP | 5.47 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|