C26H35NO2S — CID 58360443
(1S,6S)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4,6-dimethyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 58360443) has the molecular formula C26H35NO2S and a molecular weight of 425.64 g/mol. Its IUPAC name is (1S,6S)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4,6-dimethyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6S)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4,6-dimethyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 58360443 |
| Molecular Formula | C26H35NO2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (1S,6S)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4,6-dimethyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC1=CC[C@H](C(=O)N(c2csc(C#CC(C)(C)C)c2)C2CCC3(CC2)CO3)[C@@H](C)C1 |
| InChI | InChI=1S/C26H35NO2S/c1-18-6-7-23(19(2)14-18)24(28)27(20-8-12-26(13-9-20)17-29-26)21-15-22(30-16-21)10-11-25(3,4)5/h6,15-16,19-20,23H,7-9,12-14,17H2,1-5H3/t19-,20?,23-,26?/m0/s1 |
| InChIKey | OEXVYZSXMILOIO-LNVQZGFYSA-N |
| XLogP | 6.18 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|