C26H37NO3SV — CID 144574324
(1R)-N-(4,4-dimethoxycyclohexyl)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methylcyclohex-3-ene-1-carboxamide;vanadium (PubChem CID 144574324) has the molecular formula C26H37NO3SV and a molecular weight of 494.60 g/mol. Its IUPAC name is (1R)-N-(4,4-dimethoxycyclohexyl)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methylcyclohex-3-ene-1-carboxamide;vanadium.
| Compound Name | (1R)-N-(4,4-dimethoxycyclohexyl)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methylcyclohex-3-ene-1-carboxamide;vanadium |
|---|---|
| PubChem CID | 144574324 |
| Molecular Formula | C26H37NO3SV |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (1R)-N-(4,4-dimethoxycyclohexyl)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methylcyclohex-3-ene-1-carboxamide;vanadium |
| SMILES | COC1(OC)CCC(N(C(=O)[C@H]2CC=C(C)CC2)c2csc(C#CC(C)(C)C)c2)CC1.[V] |
| InChI | InChI=1S/C26H37NO3S.V/c1-19-7-9-20(10-8-19)24(28)27(21-11-15-26(29-5,30-6)16-12-21)22-17-23(31-18-22)13-14-25(2,3)4;/h7,17-18,20-21H,8-12,15-16H2,1-6H3;/t20-;/m0./s1 |
| InChIKey | QCLXTGHFCWPHOE-BDQAORGHSA-N |
| XLogP | 6.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|