C26H40N2O3S — CID 143672268
N-[5-(3,3-dimethylbut-1-ynyl)-2-methylthiophen-3-yl]-4-methyl-N-piperidin-4-ylcyclohexane-1-carboxamide;methyl formate (PubChem CID 143672268) has the molecular formula C26H40N2O3S and a molecular weight of 460.68 g/mol. Its IUPAC name is N-[5-(3,3-dimethylbut-1-ynyl)-2-methylthiophen-3-yl]-4-methyl-N-piperidin-4-ylcyclohexane-1-carboxamide;methyl formate.
| Compound Name | N-[5-(3,3-dimethylbut-1-ynyl)-2-methylthiophen-3-yl]-4-methyl-N-piperidin-4-ylcyclohexane-1-carboxamide;methyl formate |
|---|---|
| PubChem CID | 143672268 |
| Molecular Formula | C26H40N2O3S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | N-[5-(3,3-dimethylbut-1-ynyl)-2-methylthiophen-3-yl]-4-methyl-N-piperidin-4-ylcyclohexane-1-carboxamide;methyl formate |
| SMILES | COC=O.Cc1sc(C#CC(C)(C)C)cc1N(C(=O)C1CCC(C)CC1)C1CCNCC1 |
| InChI | InChI=1S/C24H36N2OS.C2H4O2/c1-17-6-8-19(9-7-17)23(27)26(20-11-14-25-15-12-20)22-16-21(28-18(22)2)10-13-24(3,4)5;1-4-2-3/h16-17,19-20,25H,6-9,11-12,14-15H2,1-5H3;2H,1H3 |
| InChIKey | DEENJYRKJMAFIT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|