C28H40NO5PS — CID 67985981
5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-dimethylphosphoryloxycyclohexyl)amino]thiophene-2-carboxylic acid (PubChem CID 67985981) has the molecular formula C28H40NO5PS and a molecular weight of 533.67 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-dimethylphosphoryloxycyclohexyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-dimethylphosphoryloxycyclohexyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67985981 |
| Molecular Formula | C28H40NO5PS |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-dimethylphosphoryloxycyclohexyl)amino]thiophene-2-carboxylic acid |
| SMILES | CC1=CC[C@@H](C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)C2CCC(OP(C)(C)=O)CC2)[C@H](C)C1 |
| InChI | InChI=1S/C28H40NO5PS/c1-18-8-13-23(19(2)16-18)26(30)29(20-9-11-21(12-10-20)34-35(6,7)33)24-17-22(14-15-28(3,4)5)36-25(24)27(31)32/h8,17,19-21,23H,9-13,16H2,1-7H3,(H,31,32)/t19-,20?,21?,23-/m1/s1 |
| InChIKey | GHTOHWPOLNTCLM-ZDTVFLJBSA-N |
| XLogP | 7.03 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|