C24H33NO3S — CID 71230566
methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-propan-2-ylamino]thiophene-2-carboxylate (PubChem CID 71230566) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-propan-2-ylamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-propan-2-ylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 71230566 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[(1R,6R)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-propan-2-ylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C#CC(C)(C)C)cc1N(C(=O)[C@@H]1CC=C(C)C[C@H]1C)C(C)C |
| InChI | InChI=1S/C24H33NO3S/c1-15(2)25(22(26)19-10-9-16(3)13-17(19)4)20-14-18(11-12-24(5,6)7)29-21(20)23(27)28-8/h9,14-15,17,19H,10,13H2,1-8H3/t17-,19-/m1/s1 |
| InChIKey | QNLYPAKRQZMWFS-IEBWSBKVSA-N |
| XLogP | 5.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|