C32H47NO3S — CID 162061746
carbanylium;1-(cyclopentyloxymethyl)-4-[[5-(3,3-dimethylbut-1-ynyl)-2H-thiophen-2-id-3-yl]-[(1R)-4-methylcyclohex-3-ene-1-carbonyl]amino]cyclohexan-1-olate (PubChem CID 162061746) has the molecular formula C32H47NO3S and a molecular weight of 525.80 g/mol. Its IUPAC name is carbanylium;1-(cyclopentyloxymethyl)-4-[[5-(3,3-dimethylbut-1-ynyl)-2H-thiophen-2-id-3-yl]-[(1R)-4-methylcyclohex-3-ene-1-carbonyl]amino]cyclohexan-1-olate.
| Compound Name | carbanylium;1-(cyclopentyloxymethyl)-4-[[5-(3,3-dimethylbut-1-ynyl)-2H-thiophen-2-id-3-yl]-[(1R)-4-methylcyclohex-3-ene-1-carbonyl]amino]cyclohexan-1-olate |
|---|---|
| PubChem CID | 162061746 |
| Molecular Formula | C32H47NO3S |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 525.33 |
| IUPAC Name | carbanylium;1-(cyclopentyloxymethyl)-4-[[5-(3,3-dimethylbut-1-ynyl)-2H-thiophen-2-id-3-yl]-[(1R)-4-methylcyclohex-3-ene-1-carbonyl]amino]cyclohexan-1-olate |
| SMILES | CC1=CC[C@H](C(=O)N(c2[c-]sc(C#CC(C)(C)C)c2)C2CCC([O-])(COC3CCCC3)CC2)CC1.[CH3+].[CH3+] |
| InChI | InChI=1S/C30H41NO3S.2CH3/c1-22-9-11-23(12-10-22)28(32)31(25-19-27(35-20-25)15-16-29(2,3)4)24-13-17-30(33,18-14-24)21-34-26-7-5-6-8-26;;/h9,19,23-24,26H,5-8,10-14,17-18,21H2,1-4H3;2*1H3/q-2;2*+1/t23-,24?,30?;;/m0../s1 |
| InChIKey | YZXYYWRHYNQKLE-PWIKPLFQSA-N |
| XLogP | 6.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|