C25H33NO2S — CID 73292202
(1R)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 73292202) has the molecular formula C25H33NO2S and a molecular weight of 411.61 g/mol. Its IUPAC name is (1R)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 73292202 |
| Molecular Formula | C25H33NO2S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (1R)-N-[5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-4-methyl-N-(1-oxaspiro[2.5]octan-6-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC1=CC[C@H](C(=O)N(c2csc(C#CC(C)(C)C)c2)C2CCC3(CC2)CO3)CC1 |
| InChI | InChI=1S/C25H33NO2S/c1-18-5-7-19(8-6-18)23(27)26(20-9-13-25(14-10-20)17-28-25)21-15-22(29-16-21)11-12-24(2,3)4/h5,15-16,19-20H,6-10,13-14,17H2,1-4H3/t19-,20?,25?/m0/s1 |
| InChIKey | LWGNUEYRTHAEHG-IXCHTMLJSA-N |
| XLogP | 5.94 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|