C23H34NO6PS — CID 88963241
methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[4-[ethoxy(methyl)phosphoryl]-4-methoxycyclohexyl]-formylamino]thiophene-2-carboxylate (PubChem CID 88963241) has the molecular formula C23H34NO6PS and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[4-[ethoxy(methyl)phosphoryl]-4-methoxycyclohexyl]-formylamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[4-[ethoxy(methyl)phosphoryl]-4-methoxycyclohexyl]-formylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 88963241 |
| Molecular Formula | C23H34NO6PS |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[[4-[ethoxy(methyl)phosphoryl]-4-methoxycyclohexyl]-formylamino]thiophene-2-carboxylate |
| SMILES | CCOP(C)(=O)C1(OC)CCC(N(C=O)c2cc(C#CC(C)(C)C)sc2C(=O)OC)CC1 |
| InChI | InChI=1S/C23H34NO6PS/c1-8-30-31(7,27)23(29-6)13-9-17(10-14-23)24(16-25)19-15-18(11-12-22(2,3)4)32-20(19)21(26)28-5/h15-17H,8-10,13-14H2,1-7H3 |
| InChIKey | RJUUQXBLKHOAKX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|