C17H26NO4PS — CID 67034337
methyl 5-(3,3-dimethylbut-1-ynyl)-3-[2-[ethoxy(methyl)phosphoryl]ethylamino]thiophene-2-carboxylate (PubChem CID 67034337) has the molecular formula C17H26NO4PS and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 5-(3,3-dimethylbut-1-ynyl)-3-[2-[ethoxy(methyl)phosphoryl]ethylamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[2-[ethoxy(methyl)phosphoryl]ethylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 67034337 |
| Molecular Formula | C17H26NO4PS |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | methyl 5-(3,3-dimethylbut-1-ynyl)-3-[2-[ethoxy(methyl)phosphoryl]ethylamino]thiophene-2-carboxylate |
| SMILES | CCOP(C)(=O)CCNc1cc(C#CC(C)(C)C)sc1C(=O)OC |
| InChI | InChI=1S/C17H26NO4PS/c1-7-22-23(6,20)11-10-18-14-12-13(8-9-17(2,3)4)24-15(14)16(19)21-5/h12,18H,7,10-11H2,1-6H3 |
| InChIKey | VHWVPVMSHXQGJC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|