C12H13BrO3S — CID 66655000
methyl 3-bromo-5-(3-methoxy-3-methylbut-1-ynyl)thiophene-2-carboxylate (PubChem CID 66655000) has the molecular formula C12H13BrO3S and a molecular weight of 317.20 g/mol. Its IUPAC name is methyl 3-bromo-5-(3-methoxy-3-methylbut-1-ynyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-bromo-5-(3-methoxy-3-methylbut-1-ynyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 66655000 |
| Molecular Formula | C12H13BrO3S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | methyl 3-bromo-5-(3-methoxy-3-methylbut-1-ynyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C#CC(C)(C)OC)cc1Br |
| InChI | InChI=1S/C12H13BrO3S/c1-12(2,16-4)6-5-8-7-9(13)10(17-8)11(14)15-3/h7H,1-4H3 |
| InChIKey | VOAZPNSFZPKCFD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|