C21H24ClO4PS — CID 59481678
3-[[(4-chloro-2-methylphenyl)-ethoxyphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid (PubChem CID 59481678) has the molecular formula C21H24ClO4PS and a molecular weight of 438.91 g/mol. Its IUPAC name is 3-[[(4-chloro-2-methylphenyl)-ethoxyphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[(4-chloro-2-methylphenyl)-ethoxyphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59481678 |
| Molecular Formula | C21H24ClO4PS |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 3-[[(4-chloro-2-methylphenyl)-ethoxyphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
| SMILES | CCOP(=O)(Cc1cc(C#CC(C)(C)C)sc1C(=O)O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C21H24ClO4PS/c1-6-26-27(25,18-8-7-16(22)11-14(18)2)13-15-12-17(9-10-21(3,4)5)28-19(15)20(23)24/h7-8,11-12H,6,13H2,1-5H3,(H,23,24) |
| InChIKey | WTDWMSWQDAIKPJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|