C18H20O4S2Si — CID 58390671
3-[(2-methylphenyl)sulfonylmethyl]-5-(2-trimethylsilylethynyl)thiophene-2-carboxylic acid (PubChem CID 58390671) has the molecular formula C18H20O4S2Si and a molecular weight of 392.57 g/mol. Its IUPAC name is 3-[(2-methylphenyl)sulfonylmethyl]-5-(2-trimethylsilylethynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[(2-methylphenyl)sulfonylmethyl]-5-(2-trimethylsilylethynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58390671 |
| Molecular Formula | C18H20O4S2Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-[(2-methylphenyl)sulfonylmethyl]-5-(2-trimethylsilylethynyl)thiophene-2-carboxylic acid |
| SMILES | Cc1ccccc1S(=O)(=O)Cc1cc(C#C[Si](C)(C)C)sc1C(=O)O |
| InChI | InChI=1S/C18H20O4S2Si/c1-13-7-5-6-8-16(13)24(21,22)12-14-11-15(9-10-25(2,3)4)23-17(14)18(19)20/h5-8,11H,12H2,1-4H3,(H,19,20) |
| InChIKey | ARRHEAZBFHYNHR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|