C15H18NO3S+ — CID 123544599
[2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-methylidene-(2-oxopropyl)azanium (PubChem CID 123544599) has the molecular formula C15H18NO3S+ and a molecular weight of 292.38 g/mol. Its IUPAC name is [2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-methylidene-(2-oxopropyl)azanium.
| Compound Name | [2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-methylidene-(2-oxopropyl)azanium |
|---|---|
| PubChem CID | 123544599 |
| Molecular Formula | C15H18NO3S+ |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [2-carboxy-5-(3,3-dimethylbut-1-ynyl)thiophen-3-yl]-methylidene-(2-oxopropyl)azanium |
| SMILES | C=[N+](CC(C)=O)c1cc(C#CC(C)(C)C)sc1C(=O)O |
| InChI | InChI=1S/C15H17NO3S/c1-10(17)9-16(5)12-8-11(6-7-15(2,3)4)20-13(12)14(18)19/h8H,5,9H2,1-4H3/p+1 |
| InChIKey | CEHOIJMFVPBGRO-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|