C20H22ClO3PS — CID 59481626
3-[[(4-chloro-2-methylphenyl)-methylphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid (PubChem CID 59481626) has the molecular formula C20H22ClO3PS and a molecular weight of 408.89 g/mol. Its IUPAC name is 3-[[(4-chloro-2-methylphenyl)-methylphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[(4-chloro-2-methylphenyl)-methylphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59481626 |
| Molecular Formula | C20H22ClO3PS |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 3-[[(4-chloro-2-methylphenyl)-methylphosphoryl]methyl]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
| SMILES | Cc1cc(Cl)ccc1P(C)(=O)Cc1cc(C#CC(C)(C)C)sc1C(=O)O |
| InChI | InChI=1S/C20H22ClO3PS/c1-13-10-15(21)6-7-17(13)25(5,24)12-14-11-16(8-9-20(2,3)4)26-18(14)19(22)23/h6-7,10-11H,12H2,1-5H3,(H,22,23) |
| InChIKey | NXVZBWIOTRSDPP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|