C23H25O4PS — CID 59481683
3-[[(2,4-dimethylphenyl)-ethoxyphosphoryl]methyl]-5-(4-methylphenyl)thiophene-2-carboxylic acid (PubChem CID 59481683) has the molecular formula C23H25O4PS and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-[[(2,4-dimethylphenyl)-ethoxyphosphoryl]methyl]-5-(4-methylphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[(2,4-dimethylphenyl)-ethoxyphosphoryl]methyl]-5-(4-methylphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59481683 |
| Molecular Formula | C23H25O4PS |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 3-[[(2,4-dimethylphenyl)-ethoxyphosphoryl]methyl]-5-(4-methylphenyl)thiophene-2-carboxylic acid |
| SMILES | CCOP(=O)(Cc1cc(-c2ccc(C)cc2)sc1C(=O)O)c1ccc(C)cc1C |
| InChI | InChI=1S/C23H25O4PS/c1-5-27-28(26,20-11-8-16(3)12-17(20)4)14-19-13-21(29-22(19)23(24)25)18-9-6-15(2)7-10-18/h6-13H,5,14H2,1-4H3,(H,24,25) |
| InChIKey | MVLVPPHGYZUXKK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|