C24H23ClNO4PS — CID 89035046
5-(4-chlorophenyl)-3-[[(2,4-dimethylphenyl)-pent-4-ynoxyphosphoryl]amino]thiophene-2-carboxylic acid (PubChem CID 89035046) has the molecular formula C24H23ClNO4PS and a molecular weight of 487.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[[(2,4-dimethylphenyl)-pent-4-ynoxyphosphoryl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(4-chlorophenyl)-3-[[(2,4-dimethylphenyl)-pent-4-ynoxyphosphoryl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 89035046 |
| Molecular Formula | C24H23ClNO4PS |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[[(2,4-dimethylphenyl)-pent-4-ynoxyphosphoryl]amino]thiophene-2-carboxylic acid |
| SMILES | C#CCCCOP(=O)(Nc1cc(-c2ccc(Cl)cc2)sc1C(=O)O)c1ccc(C)cc1C |
| InChI | InChI=1S/C24H23ClNO4PS/c1-4-5-6-13-30-31(29,21-12-7-16(2)14-17(21)3)26-20-15-22(32-23(20)24(27)28)18-8-10-19(25)11-9-18/h1,7-12,14-15H,5-6,13H2,2-3H3,(H,26,29)(H,27,28) |
| InChIKey | APMOOYXFDWMYIW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|