C20H21N2O5PS — CID 59481849
3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-5-(4-methoxy-3-pyridinyl)thiophene-2-carboxylic acid (PubChem CID 59481849) has the molecular formula C20H21N2O5PS and a molecular weight of 432.44 g/mol. Its IUPAC name is 3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-5-(4-methoxy-3-pyridinyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-5-(4-methoxy-3-pyridinyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59481849 |
| Molecular Formula | C20H21N2O5PS |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-5-(4-methoxy-3-pyridinyl)thiophene-2-carboxylic acid |
| SMILES | COc1ccncc1-c1cc(NP(=O)(OC)c2ccc(C)cc2C)c(C(=O)O)s1 |
| InChI | InChI=1S/C20H21N2O5PS/c1-12-5-6-17(13(2)9-12)28(25,27-4)22-15-10-18(29-19(15)20(23)24)14-11-21-8-7-16(14)26-3/h5-11H,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | NCOYTFCOJPFMDX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|