C19H19N2O4PS — CID 46899150
4-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-2-phenyl-1,3-thiazole-5-carboxylic acid (PubChem CID 46899150) has the molecular formula C19H19N2O4PS and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-2-phenyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-2-phenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 46899150 |
| Molecular Formula | C19H19N2O4PS |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]-2-phenyl-1,3-thiazole-5-carboxylic acid |
| SMILES | COP(=O)(Nc1nc(-c2ccccc2)sc1C(=O)O)c1ccc(C)cc1C |
| InChI | InChI=1S/C19H19N2O4PS/c1-12-9-10-15(13(2)11-12)26(24,25-3)21-17-16(19(22)23)27-18(20-17)14-7-5-4-6-8-14/h4-11H,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | MCIOZUCOEFNWRO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|