C17H11ClN2O3S — CID 10126129
4-[(4-chlorobenzoyl)amino]-2-phenyl-1,3-thiazole-5-carboxylic acid (PubChem CID 10126129) has the molecular formula C17H11ClN2O3S and a molecular weight of 358.81 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-2-phenyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-2-phenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 10126129 |
| Molecular Formula | C17H11ClN2O3S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-2-phenyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(Nc1nc(-c2ccccc2)sc1C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClN2O3S/c18-12-8-6-10(7-9-12)15(21)19-14-13(17(22)23)24-16(20-14)11-4-2-1-3-5-11/h1-9H,(H,19,21)(H,22,23) |
| InChIKey | ULMBEMZRULRHCA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |