C20H19ClNO4PS — CID 70853692
5-(3-chlorophenyl)-3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]thiophene-2-carboxylic acid (PubChem CID 70853692) has the molecular formula C20H19ClNO4PS and a molecular weight of 435.87 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3-chlorophenyl)-3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 70853692 |
| Molecular Formula | C20H19ClNO4PS |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 5-(3-chlorophenyl)-3-[[(2,4-dimethylphenyl)-methoxyphosphoryl]amino]thiophene-2-carboxylic acid |
| SMILES | COP(=O)(Nc1cc(-c2cccc(Cl)c2)sc1C(=O)O)c1ccc(C)cc1C |
| InChI | InChI=1S/C20H19ClNO4PS/c1-12-7-8-17(13(2)9-12)27(25,26-3)22-16-11-18(28-19(16)20(23)24)14-5-4-6-15(21)10-14/h4-11H,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | MVCQMAVDQBSHHQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|