C23H23NO5S — CID 90950972
3-[[1-(2,4-dimethylphenyl)-1-methoxy-2-oxoethyl]amino]-5-(4-methoxyphenyl)thiophene-2-carboxylic acid (PubChem CID 90950972) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[[1-(2,4-dimethylphenyl)-1-methoxy-2-oxoethyl]amino]-5-(4-methoxyphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[1-(2,4-dimethylphenyl)-1-methoxy-2-oxoethyl]amino]-5-(4-methoxyphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90950972 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-[[1-(2,4-dimethylphenyl)-1-methoxy-2-oxoethyl]amino]-5-(4-methoxyphenyl)thiophene-2-carboxylic acid |
| SMILES | COc1ccc(-c2cc(NC(C=O)(OC)c3ccc(C)cc3C)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C23H23NO5S/c1-14-5-10-18(15(2)11-14)23(13-25,29-4)24-19-12-20(30-21(19)22(26)27)16-6-8-17(28-3)9-7-16/h5-13,24H,1-4H3,(H,26,27) |
| InChIKey | QRJSQCOMSVIKRA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|