C27H23INO3PS — CID 59481844
5-[4-(1-benzofuran-2-yl)phenyl]-N-[(2,4-dimethylphenyl)-methoxyphosphoryl]-2-iodothiophen-3-amine (PubChem CID 59481844) has the molecular formula C27H23INO3PS and a molecular weight of 599.43 g/mol. Its IUPAC name is 5-[4-(1-benzofuran-2-yl)phenyl]-N-[(2,4-dimethylphenyl)-methoxyphosphoryl]-2-iodothiophen-3-amine.
| Compound Name | 5-[4-(1-benzofuran-2-yl)phenyl]-N-[(2,4-dimethylphenyl)-methoxyphosphoryl]-2-iodothiophen-3-amine |
|---|---|
| PubChem CID | 59481844 |
| Molecular Formula | C27H23INO3PS |
| Molecular Weight | 599.43 g/mol |
| Exact Mass | 599.02 |
| IUPAC Name | 5-[4-(1-benzofuran-2-yl)phenyl]-N-[(2,4-dimethylphenyl)-methoxyphosphoryl]-2-iodothiophen-3-amine |
| SMILES | COP(=O)(Nc1cc(-c2ccc(-c3cc4ccccc4o3)cc2)sc1I)c1ccc(C)cc1C |
| InChI | InChI=1S/C27H23INO3PS/c1-17-8-13-25(18(2)14-17)33(30,31-3)29-22-16-26(34-27(22)28)20-11-9-19(10-12-20)24-15-21-6-4-5-7-23(21)32-24/h4-16H,1-3H3,(H,29,30) |
| InChIKey | ZZQKLOTXQASCLM-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.43 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|