C25H18IN2O5PS — CID 70853853
5-(4-furo[3,2-b]pyridin-2-ylphenyl)-3-[[hydroxy-(2-iodo-4-methylphenyl)phosphoryl]amino]thiophene-2-carboxylic acid (PubChem CID 70853853) has the molecular formula C25H18IN2O5PS and a molecular weight of 616.37 g/mol. Its IUPAC name is 5-(4-furo[3,2-b]pyridin-2-ylphenyl)-3-[[hydroxy-(2-iodo-4-methylphenyl)phosphoryl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(4-furo[3,2-b]pyridin-2-ylphenyl)-3-[[hydroxy-(2-iodo-4-methylphenyl)phosphoryl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 70853853 |
| Molecular Formula | C25H18IN2O5PS |
| Molecular Weight | 616.37 g/mol |
| Exact Mass | 615.97 |
| IUPAC Name | 5-(4-furo[3,2-b]pyridin-2-ylphenyl)-3-[[hydroxy-(2-iodo-4-methylphenyl)phosphoryl]amino]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(P(=O)(O)Nc2cc(-c3ccc(-c4cc5ncccc5o4)cc3)sc2C(=O)O)c(I)c1 |
| InChI | InChI=1S/C25H18IN2O5PS/c1-14-4-9-22(17(26)11-14)34(31,32)28-19-13-23(35-24(19)25(29)30)16-7-5-15(6-8-16)21-12-18-20(33-21)3-2-10-27-18/h2-13H,1H3,(H,29,30)(H2,28,31,32) |
| InChIKey | OJMXPLWUBBXEOR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.37 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|