C27H29N2O5PS — CID 59481581
3-[[ethoxy-(4-methylcyclohexyl)phosphoryl]amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid (PubChem CID 59481581) has the molecular formula C27H29N2O5PS and a molecular weight of 524.58 g/mol. Its IUPAC name is 3-[[ethoxy-(4-methylcyclohexyl)phosphoryl]amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[ethoxy-(4-methylcyclohexyl)phosphoryl]amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59481581 |
| Molecular Formula | C27H29N2O5PS |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 3-[[ethoxy-(4-methylcyclohexyl)phosphoryl]amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid |
| SMILES | CCO[P@@](=O)(Nc1cc(-c2ccc(-c3cc4ncccc4o3)cc2)sc1C(=O)O)C1CCC(C)CC1 |
| InChI | InChI=1S/C27H29N2O5PS/c1-3-33-35(32,20-12-6-17(2)7-13-20)29-22-16-25(36-26(22)27(30)31)19-10-8-18(9-11-19)24-15-21-23(34-24)5-4-14-28-21/h4-5,8-11,14-17,20H,3,6-7,12-13H2,1-2H3,(H,29,32)(H,30,31)/t17?,20?,35-/m1/s1 |
| InChIKey | OPDFXCLDCQZGTJ-JFHXLRJVSA-N |
| XLogP | 8.14 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|