C11H23N — CID 123564390
1,2-dimethyl-2-prop-2-enylpyrrolidine;ethane (PubChem CID 123564390) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 1,2-dimethyl-2-prop-2-enylpyrrolidine;ethane.
| Compound Name | 1,2-dimethyl-2-prop-2-enylpyrrolidine;ethane |
|---|---|
| PubChem CID | 123564390 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1,2-dimethyl-2-prop-2-enylpyrrolidine;ethane |
| SMILES | C=CCC1(C)CCCN1C.CC |
| InChI | InChI=1S/C9H17N.C2H6/c1-4-6-9(2)7-5-8-10(9)3;1-2/h4H,1,5-8H2,2-3H3;1-2H3 |
| InChIKey | FWARLHDSPPFOFS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|