C13H23F2N — CID 151270858
(3R)-1-tert-butyl-3-(1,1-difluoropent-4-enyl)pyrrolidine (PubChem CID 151270858) has the molecular formula C13H23F2N and a molecular weight of 231.33 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-(1,1-difluoropent-4-enyl)pyrrolidine.
| Compound Name | (3R)-1-tert-butyl-3-(1,1-difluoropent-4-enyl)pyrrolidine |
|---|---|
| PubChem CID | 151270858 |
| Molecular Formula | C13H23F2N |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | (3R)-1-tert-butyl-3-(1,1-difluoropent-4-enyl)pyrrolidine |
| SMILES | C=CCCC(F)(F)[C@@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H23F2N/c1-5-6-8-13(14,15)11-7-9-16(10-11)12(2,3)4/h5,11H,1,6-10H2,2-4H3/t11-/m1/s1 |
| InChIKey | NWIICGYSMKAXOB-LLVKDONJSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|