C11H20FN — CID 170622490
(4Z)-2-ethyl-4-(fluoromethylidene)-1-methyl-2-propylpyrrolidine (PubChem CID 170622490) has the molecular formula C11H20FN and a molecular weight of 185.29 g/mol. Its IUPAC name is (4Z)-2-ethyl-4-(fluoromethylidene)-1-methyl-2-propylpyrrolidine.
| Compound Name | (4Z)-2-ethyl-4-(fluoromethylidene)-1-methyl-2-propylpyrrolidine |
|---|---|
| PubChem CID | 170622490 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | (4Z)-2-ethyl-4-(fluoromethylidene)-1-methyl-2-propylpyrrolidine |
| SMILES | CCCC1(CC)C/C(=C/F)CN1C |
| InChI | InChI=1S/C11H20FN/c1-4-6-11(5-2)7-10(8-12)9-13(11)3/h8H,4-7,9H2,1-3H3/b10-8- |
| InChIKey | LKWQRDARQZKWEU-NTMALXAHSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |