C15H29FN+ — CID 146650902
butyl-[2-fluoro-1-(3-methylidenecyclopentyl)propan-2-yl]-dimethylazanium (PubChem CID 146650902) has the molecular formula C15H29FN+ and a molecular weight of 242.40 g/mol. Its IUPAC name is butyl-[2-fluoro-1-(3-methylidenecyclopentyl)propan-2-yl]-dimethylazanium.
| Compound Name | butyl-[2-fluoro-1-(3-methylidenecyclopentyl)propan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 146650902 |
| Molecular Formula | C15H29FN+ |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.23 |
| IUPAC Name | butyl-[2-fluoro-1-(3-methylidenecyclopentyl)propan-2-yl]-dimethylazanium |
| SMILES | C=C1CCC(CC(C)(F)[N+](C)(C)CCCC)C1 |
| InChI | InChI=1S/C15H29FN/c1-6-7-10-17(4,5)15(3,16)12-14-9-8-13(2)11-14/h14H,2,6-12H2,1,3-5H3/q+1 |
| InChIKey | WQRZWLRRCMKWAS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|