C20H24N4O4S2 — CID 123564398
O-methyl 4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carbothioate (PubChem CID 123564398) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is O-methyl 4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carbothioate.
| Compound Name | O-methyl 4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carbothioate |
|---|---|
| PubChem CID | 123564398 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | O-methyl 4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carbothioate |
| SMILES | COC(=S)N1CCC(Oc2cc(N3CCc4cc(S(C)(=O)=O)ccc43)ncn2)CC1 |
| InChI | InChI=1S/C20H24N4O4S2/c1-27-20(29)23-8-6-15(7-9-23)28-19-12-18(21-13-22-19)24-10-5-14-11-16(30(2,25)26)3-4-17(14)24/h3-4,11-13,15H,5-10H2,1-2H3 |
| InChIKey | PRTWIFLDZWQHCN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|