C19H21FN4O5S — CID 68671305
2-fluoro-4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 68671305) has the molecular formula C19H21FN4O5S and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-fluoro-4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 2-fluoro-4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68671305 |
| Molecular Formula | C19H21FN4O5S |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-fluoro-4-[6-(5-methylsulfonyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCN2c1cc(OC2CCN(C(=O)O)C(F)C2)ncn1 |
| InChI | InChI=1S/C19H21FN4O5S/c1-30(27,28)14-2-3-15-12(8-14)4-6-23(15)17-10-18(22-11-21-17)29-13-5-7-24(19(25)26)16(20)9-13/h2-3,8,10-11,13,16H,4-7,9H2,1H3,(H,25,26) |
| InChIKey | HZDHTJWYFWMZOM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|